C8H20N8O — CID 173129987
2-[[(2S)-6-amino-6-(diaminomethylideneamino)-1-oxohexan-2-yl]amino]guanidine (PubChem CID 173129987) has the molecular formula C8H20N8O and a molecular weight of 244.30 g/mol. Its IUPAC name is 2-[[(2S)-6-amino-6-(diaminomethylideneamino)-1-oxohexan-2-yl]amino]guanidine.
| Compound Name | 2-[[(2S)-6-amino-6-(diaminomethylideneamino)-1-oxohexan-2-yl]amino]guanidine |
|---|---|
| PubChem CID | 173129987 |
| Molecular Formula | C8H20N8O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 2-[[(2S)-6-amino-6-(diaminomethylideneamino)-1-oxohexan-2-yl]amino]guanidine |
| SMILES | NC(N)=NN[C@H](C=O)CCCC(N)N=C(N)N |
| InChI | InChI=1S/C8H20N8O/c9-6(14-7(10)11)3-1-2-5(4-17)15-16-8(12)13/h4-6,15H,1-3,9H2,(H4,10,11,14)(H4,12,13,16)/t5-,6?/m0/s1 |
| InChIKey | DJDHMWWHWCGYIY-ZBHICJROSA-N |
| XLogP | -2.94 |
| TPSA | 183.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | -2.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|