C6H15N4NaO — CID 175474256
sodium;2-[(4S)-4-amino-5-oxopentyl]guanidine;hydride (PubChem CID 175474256) has the molecular formula C6H15N4NaO and a molecular weight of 182.20 g/mol. Its IUPAC name is sodium;2-[(4S)-4-amino-5-oxopentyl]guanidine;hydride.
| Compound Name | sodium;2-[(4S)-4-amino-5-oxopentyl]guanidine;hydride |
|---|---|
| PubChem CID | 175474256 |
| Molecular Formula | C6H15N4NaO |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | sodium;2-[(4S)-4-amino-5-oxopentyl]guanidine;hydride |
| SMILES | NC(N)=NCCC[C@H](N)C=O.[H-].[Na+] |
| InChI | InChI=1S/C6H14N4O.Na.H/c7-5(4-11)2-1-3-10-6(8)9;;/h4-5H,1-3,7H2,(H4,8,9,10);;/q;+1;-1/t5-;;/m0../s1 |
| InChIKey | VPZBQCWUCJJCMY-XRIGFGBMSA-N |
| XLogP | -4.32 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | -4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|