C14H37N5O2 — CID 159342046
(2R)-2-amino-3-methylbutanal;2-[(4R)-4-amino-5-oxopentyl]guanidine;methane (PubChem CID 159342046) has the molecular formula C14H37N5O2 and a molecular weight of 307.48 g/mol. Its IUPAC name is (2R)-2-amino-3-methylbutanal;2-[(4R)-4-amino-5-oxopentyl]guanidine;methane.
| Compound Name | (2R)-2-amino-3-methylbutanal;2-[(4R)-4-amino-5-oxopentyl]guanidine;methane |
|---|---|
| PubChem CID | 159342046 |
| Molecular Formula | C14H37N5O2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.29 |
| IUPAC Name | (2R)-2-amino-3-methylbutanal;2-[(4R)-4-amino-5-oxopentyl]guanidine;methane |
| SMILES | C.C.C.CC(C)[C@@H](N)C=O.NC(N)=NCCC[C@@H](N)C=O |
| InChI | InChI=1S/C6H14N4O.C5H11NO.3CH4/c7-5(4-11)2-1-3-10-6(8)9;1-4(2)5(6)3-7;;;/h4-5H,1-3,7H2,(H4,8,9,10);3-5H,6H2,1-2H3;3*1H4/t2*5-;;;/m10.../s1 |
| InChIKey | LGGIZOLMMWRPRB-CPKKIPLVSA-N |
| XLogP | 0.64 |
| TPSA | 150.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|