C14H29N5O2 — CID 54479657
2-[(4S)-4-amino-5-oxopentyl]guanidine;1-piperidin-1-ylpropan-2-one (PubChem CID 54479657) has the molecular formula C14H29N5O2 and a molecular weight of 299.42 g/mol. Its IUPAC name is 2-[(4S)-4-amino-5-oxopentyl]guanidine;1-piperidin-1-ylpropan-2-one.
| Compound Name | 2-[(4S)-4-amino-5-oxopentyl]guanidine;1-piperidin-1-ylpropan-2-one |
|---|---|
| PubChem CID | 54479657 |
| Molecular Formula | C14H29N5O2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.23 |
| IUPAC Name | 2-[(4S)-4-amino-5-oxopentyl]guanidine;1-piperidin-1-ylpropan-2-one |
| SMILES | CC(=O)CN1CCCCC1.NC(N)=NCCC[C@H](N)C=O |
| InChI | InChI=1S/C8H15NO.C6H14N4O/c1-8(10)7-9-5-3-2-4-6-9;7-5(4-11)2-1-3-10-6(8)9/h2-7H2,1H3;4-5H,1-3,7H2,(H4,8,9,10)/t;5-/m.0/s1 |
| InChIKey | XOCNTLQCRHUYKE-ZSCHJXSPSA-N |
| XLogP | -0.37 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|