C7H16N4O — CID 22853450
2-[(5S)-5-amino-6-oxohexyl]guanidine (PubChem CID 22853450) has the molecular formula C7H16N4O and a molecular weight of 172.23 g/mol. Its IUPAC name is 2-[(5S)-5-amino-6-oxohexyl]guanidine.
| Compound Name | 2-[(5S)-5-amino-6-oxohexyl]guanidine |
|---|---|
| PubChem CID | 22853450 |
| Molecular Formula | C7H16N4O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 2-[(5S)-5-amino-6-oxohexyl]guanidine |
| SMILES | NC(N)=NCCCC[C@H](N)C=O |
| InChI | InChI=1S/C7H16N4O/c8-6(5-12)3-1-2-4-11-7(9)10/h5-6H,1-4,8H2,(H4,9,10,11)/t6-/m0/s1 |
| InChIKey | SGPRTOLFSGXRPV-LURJTMIESA-N |
| XLogP | -1.04 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|