C16H23O5PS — CID 22885220
[(1R,5R)-5-(diethoxyphosphorylmethoxy)cyclopent-2-en-1-yl]sulfinylbenzene (PubChem CID 22885220) has the molecular formula C16H23O5PS and a molecular weight of 358.40 g/mol. Its IUPAC name is [(1R,5R)-5-(diethoxyphosphorylmethoxy)cyclopent-2-en-1-yl]sulfinylbenzene.
| Compound Name | [(1R,5R)-5-(diethoxyphosphorylmethoxy)cyclopent-2-en-1-yl]sulfinylbenzene |
|---|---|
| PubChem CID | 22885220 |
| Molecular Formula | C16H23O5PS |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | [(1R,5R)-5-(diethoxyphosphorylmethoxy)cyclopent-2-en-1-yl]sulfinylbenzene |
| SMILES | CCOP(=O)(CO[C@@H]1CC=C[C@H]1S(=O)c1ccccc1)OCC |
| InChI | InChI=1S/C16H23O5PS/c1-3-20-22(17,21-4-2)13-19-15-11-8-12-16(15)23(18)14-9-6-5-7-10-14/h5-10,12,15-16H,3-4,11,13H2,1-2H3/t15-,16-,23?/m1/s1 |
| InChIKey | WGQLIKVVDSOIBA-LHVRJDQKSA-N |
| XLogP | 3.73 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|