C15H23NO4 — CID 22886393
3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)propyl 2,2-dimethylbutanoate (PubChem CID 22886393) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)propyl 2,2-dimethylbutanoate.
| Compound Name | 3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)propyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 22886393 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 3-(3,4-dimethyl-2,5-dioxopyrrol-1-yl)propyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCCN1C(=O)C(C)=C(C)C1=O |
| InChI | InChI=1S/C15H23NO4/c1-6-15(4,5)14(19)20-9-7-8-16-12(17)10(2)11(3)13(16)18/h6-9H2,1-5H3 |
| InChIKey | AQPFDEPHEOETQX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|