C32H29N3O5 — CID 22887562
quinolin-2-yl N-[tris(4-methoxyphenyl)methylamino]carbamate (PubChem CID 22887562) has the molecular formula C32H29N3O5 and a molecular weight of 535.60 g/mol. Its IUPAC name is quinolin-2-yl N-[tris(4-methoxyphenyl)methylamino]carbamate.
| Compound Name | quinolin-2-yl N-[tris(4-methoxyphenyl)methylamino]carbamate |
|---|---|
| PubChem CID | 22887562 |
| Molecular Formula | C32H29N3O5 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | quinolin-2-yl N-[tris(4-methoxyphenyl)methylamino]carbamate |
| SMILES | COc1ccc(C(NNC(=O)Oc2ccc3ccccc3n2)(c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H29N3O5/c1-37-26-15-9-23(10-16-26)32(24-11-17-27(38-2)18-12-24,25-13-19-28(39-3)20-14-25)35-34-31(36)40-30-21-8-22-6-4-5-7-29(22)33-30/h4-21,35H,1-3H3,(H,34,36) |
| InChIKey | PIIGTQILPTXEHI-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|