About 2-aminoacetamide;quinolin-2-yl hydrogen carbonate
2-aminoacetamide;quinolin-2-yl hydrogen carbonate (PubChem CID 22446093) has the molecular formula C12H13N3O4
and a molecular weight of 263.25 g/mol. Its IUPAC name is 2-aminoacetamide;quinolin-2-yl hydrogen carbonate.
Molecular Properties
| Compound Name | 2-aminoacetamide;quinolin-2-yl hydrogen carbonate |
| PubChem CID | 22446093 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 2-aminoacetamide;quinolin-2-yl hydrogen carbonate |
| SMILES | NCC(N)=O.O=C(O)Oc1ccc2ccccc2n1 |
| InChI | InChI=1S/C10H7NO3.C2H6N2O/c12-10(13)14-9-6-5-7-3-1-2-4-8(7)11-9;3-1-2(4)5/h1-6H,(H,12,13);1,3H2,(H2,4,5) |
| InChIKey | WZZHCHINBSOWGE-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 128.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-aminoacetamide;quinolin-2-yl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetamide;quinolin-2-yl hydrogen carbonate?
The IUPAC name of 2-aminoacetamide;quinolin-2-yl hydrogen carbonate (CID 22446093) is 2-aminoacetamide;quinolin-2-yl hydrogen carbonate.
What is the SMILES notation for 2-aminoacetamide;quinolin-2-yl hydrogen carbonate?
The canonical SMILES for 2-aminoacetamide;quinolin-2-yl hydrogen carbonate is NCC(N)=O.O=C(O)Oc1ccc2ccccc2n1.
What is the InChIKey of 2-aminoacetamide;quinolin-2-yl hydrogen carbonate?
The InChIKey is WZZHCHINBSOWGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO3.C2H6N2O/c12-10(13)14-9-6-5-7-3-1-2-4-8(7)11-9;3-1-2(4)5/h1-6H,(H,12,13);1,3H2,(H2,4,5).
What are the key properties of 2-aminoacetamide;quinolin-2-yl hydrogen carbonate?
2-aminoacetamide;quinolin-2-yl hydrogen carbonate has a molecular weight of 263.25 g/mol, XLogP of 0.72, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetamide;quinolin-2-yl hydrogen carbonate is sourced from PubChem (CID 22446093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).