C12H23NO2 — CID 22887942
2-methyl-7-(propan-2-ylamino)octane-3,6-dione (PubChem CID 22887942) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 2-methyl-7-(propan-2-ylamino)octane-3,6-dione.
| Compound Name | 2-methyl-7-(propan-2-ylamino)octane-3,6-dione |
|---|---|
| PubChem CID | 22887942 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 2-methyl-7-(propan-2-ylamino)octane-3,6-dione |
| SMILES | CC(C)NC(C)C(=O)CCC(=O)C(C)C |
| InChI | InChI=1S/C12H23NO2/c1-8(2)11(14)6-7-12(15)10(5)13-9(3)4/h8-10,13H,6-7H2,1-5H3 |
| InChIKey | RJORRRCCZHQZAC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |