C15H15NO5 — CID 22890145
2-[(6,7-dimethyl-2-oxochromene-3-carbonyl)-methylamino]acetic acid (PubChem CID 22890145) has the molecular formula C15H15NO5 and a molecular weight of 289.29 g/mol. Its IUPAC name is 2-[(6,7-dimethyl-2-oxochromene-3-carbonyl)-methylamino]acetic acid.
| Compound Name | 2-[(6,7-dimethyl-2-oxochromene-3-carbonyl)-methylamino]acetic acid |
|---|---|
| PubChem CID | 22890145 |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 2-[(6,7-dimethyl-2-oxochromene-3-carbonyl)-methylamino]acetic acid |
| SMILES | Cc1cc2cc(C(=O)N(C)CC(=O)O)c(=O)oc2cc1C |
| InChI | InChI=1S/C15H15NO5/c1-8-4-10-6-11(14(19)16(3)7-13(17)18)15(20)21-12(10)5-9(8)2/h4-6H,7H2,1-3H3,(H,17,18) |
| InChIKey | NGGWTEDGWSSOEF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|