C33H32FNO4 — CID 22895160
1-[4-[2-(2-fluorophenyl)-6,8,10-trimethoxybenzo[h]chromen-2-yl]phenyl]piperidine (PubChem CID 22895160) has the molecular formula C33H32FNO4 and a molecular weight of 525.62 g/mol. Its IUPAC name is 1-[4-[2-(2-fluorophenyl)-6,8,10-trimethoxybenzo[h]chromen-2-yl]phenyl]piperidine.
| Compound Name | 1-[4-[2-(2-fluorophenyl)-6,8,10-trimethoxybenzo[h]chromen-2-yl]phenyl]piperidine |
|---|---|
| PubChem CID | 22895160 |
| Molecular Formula | C33H32FNO4 |
| Molecular Weight | 525.62 g/mol |
| Exact Mass | 525.23 |
| IUPAC Name | 1-[4-[2-(2-fluorophenyl)-6,8,10-trimethoxybenzo[h]chromen-2-yl]phenyl]piperidine |
| SMILES | COc1cc(OC)c2c3c(cc(OC)c2c1)C=CC(c1ccc(N2CCCCC2)cc1)(c1ccccc1F)O3 |
| InChI | InChI=1S/C33H32FNO4/c1-36-25-20-26-29(37-2)19-22-15-16-33(27-9-5-6-10-28(27)34,39-32(22)31(26)30(21-25)38-3)23-11-13-24(14-12-23)35-17-7-4-8-18-35/h5-6,9-16,19-21H,4,7-8,17-18H2,1-3H3 |
| InChIKey | XQSQWMXZGLPFJG-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.62 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|