C21H36O6 — CID 22895761
1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 4-methyltricyclo[5.2.1.02,6]decane-8-carboxylate (PubChem CID 22895761) has the molecular formula C21H36O6 and a molecular weight of 384.51 g/mol. Its IUPAC name is 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 4-methyltricyclo[5.2.1.02,6]decane-8-carboxylate.
| Compound Name | 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 4-methyltricyclo[5.2.1.02,6]decane-8-carboxylate |
|---|---|
| PubChem CID | 22895761 |
| Molecular Formula | C21H36O6 |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 1-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl 4-methyltricyclo[5.2.1.02,6]decane-8-carboxylate |
| SMILES | COCCOCCOCCOC(C)OC(=O)C1CC2CC1C1CC(C)CC21 |
| InChI | InChI=1S/C21H36O6/c1-14-10-17-16-12-19(18(17)11-14)20(13-16)21(22)27-15(2)26-9-8-25-7-6-24-5-4-23-3/h14-20H,4-13H2,1-3H3 |
| InChIKey | DSNUMRBAEAMOMT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|