C44H57N5O6 — CID 22896026
[6-isocyano-2-[4-methyl-3-[(5-methyl-2-octoxyphenyl)methyl]phenyl]-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] morpholine-4-carboxylate (PubChem CID 22896026) has the molecular formula C44H57N5O6 and a molecular weight of 751.97 g/mol. Its IUPAC name is [6-isocyano-2-[4-methyl-3-[(5-methyl-2-octoxyphenyl)methyl]phenyl]-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] morpholine-4-carboxylate.
| Compound Name | [6-isocyano-2-[4-methyl-3-[(5-methyl-2-octoxyphenyl)methyl]phenyl]-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] morpholine-4-carboxylate |
|---|---|
| PubChem CID | 22896026 |
| Molecular Formula | C44H57N5O6 |
| Molecular Weight | 751.97 g/mol |
| Exact Mass | 751.43 |
| IUPAC Name | [6-isocyano-2-[4-methyl-3-[(5-methyl-2-octoxyphenyl)methyl]phenyl]-7-(2,4,6-trimethylcyclohexyl)oxycarbonyl-3H-pyrrolo[1,2-b][1,2,4]triazol-5-yl] morpholine-4-carboxylate |
| SMILES | [C-]#[N+]c1c(C(=O)OC2C(C)CC(C)CC2C)c2nc(-c3ccc(C)c(Cc4cc(C)ccc4OCCCCCCCC)c3)[nH]n2c1OC(=O)N1CCOCC1 |
| InChI | InChI=1S/C44H57N5O6/c1-8-9-10-11-12-13-20-53-36-17-14-28(2)25-35(36)27-34-26-33(16-15-30(34)4)40-46-41-37(43(50)54-39-31(5)23-29(3)24-32(39)6)38(45-7)42(49(41)47-40)55-44(51)48-18-21-52-22-19-48/h14-17,25-26,29,31-32,39H,8-13,18-24,27H2,1-6H3,(H,46,47) |
| InChIKey | MVEHGBYMNVEHDB-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 111.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.97 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|