C20H22N4O4S — CID 22900426
2-[(3E)-3-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-5-isocyano-4-methyl-2,6-dioxo-1-pyridinyl]ethanesulfonamide (PubChem CID 22900426) has the molecular formula C20H22N4O4S and a molecular weight of 414.49 g/mol. Its IUPAC name is 2-[(3E)-3-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-5-isocyano-4-methyl-2,6-dioxo-1-pyridinyl]ethanesulfonamide.
| Compound Name | 2-[(3E)-3-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-5-isocyano-4-methyl-2,6-dioxo-1-pyridinyl]ethanesulfonamide |
|---|---|
| PubChem CID | 22900426 |
| Molecular Formula | C20H22N4O4S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 2-[(3E)-3-[(E)-3-[4-(dimethylamino)phenyl]prop-2-enylidene]-5-isocyano-4-methyl-2,6-dioxo-1-pyridinyl]ethanesulfonamide |
| SMILES | [C-]#[N+]C1=C(C)/C(=C\C=C\c2ccc(N(C)C)cc2)C(=O)N(CCS(N)(=O)=O)C1=O |
| InChI | InChI=1S/C20H22N4O4S/c1-14-17(7-5-6-15-8-10-16(11-9-15)23(3)4)19(25)24(12-13-29(21,27)28)20(26)18(14)22-2/h5-11H,12-13H2,1,3-4H3,(H2,21,27,28)/b6-5+,17-7+ |
| InChIKey | MTYXHYRDNNEGKR-FRRFCNHWSA-N |
| XLogP | 1.54 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|