C20H6F16O4 — CID 22908516
4-[4-carboxy-3-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)phenyl]-2-(1,1,2,2,2-pentafluoroethyl)-6-(trifluoromethyl)benzoic acid (PubChem CID 22908516) has the molecular formula C20H6F16O4 and a molecular weight of 614.23 g/mol. Its IUPAC name is 4-[4-carboxy-3-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)phenyl]-2-(1,1,2,2,2-pentafluoroethyl)-6-(trifluoromethyl)benzoic acid.
| Compound Name | 4-[4-carboxy-3-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)phenyl]-2-(1,1,2,2,2-pentafluoroethyl)-6-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 22908516 |
| Molecular Formula | C20H6F16O4 |
| Molecular Weight | 614.23 g/mol |
| Exact Mass | 614.00 |
| IUPAC Name | 4-[4-carboxy-3-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)phenyl]-2-(1,1,2,2,2-pentafluoroethyl)-6-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1c(C(F)(F)F)cc(-c2cc(C(F)(F)F)c(C(=O)O)c(C(F)(F)C(F)(F)F)c2)cc1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H6F16O4/c21-15(22,19(31,32)33)7-1-5(3-9(17(25,26)27)11(7)13(37)38)6-2-8(16(23,24)20(34,35)36)12(14(39)40)10(4-6)18(28,29)30/h1-4H,(H,37,38)(H,39,40) |
| InChIKey | JNBVABSEXKNFHX-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.23 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|