C28H37N3O3 — CID 22911269
N-[2-[3-[4-(4-methoxyphenyl)imidazol-1-yl]propoxy]-6-methylphenyl]octanamide (PubChem CID 22911269) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is N-[2-[3-[4-(4-methoxyphenyl)imidazol-1-yl]propoxy]-6-methylphenyl]octanamide.
| Compound Name | N-[2-[3-[4-(4-methoxyphenyl)imidazol-1-yl]propoxy]-6-methylphenyl]octanamide |
|---|---|
| PubChem CID | 22911269 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | N-[2-[3-[4-(4-methoxyphenyl)imidazol-1-yl]propoxy]-6-methylphenyl]octanamide |
| SMILES | CCCCCCCC(=O)Nc1c(C)cccc1OCCCn1cnc(-c2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C28H37N3O3/c1-4-5-6-7-8-13-27(32)30-28-22(2)11-9-12-26(28)34-19-10-18-31-20-25(29-21-31)23-14-16-24(33-3)17-15-23/h9,11-12,14-17,20-21H,4-8,10,13,18-19H2,1-3H3,(H,30,32) |
| InChIKey | YEZPIEOCOJMHKV-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|