C21H31F3O3 — CID 22913241
1-phenylethyl 2-decoxy-3,3,3-trifluoropropanoate (PubChem CID 22913241) has the molecular formula C21H31F3O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is 1-phenylethyl 2-decoxy-3,3,3-trifluoropropanoate.
| Compound Name | 1-phenylethyl 2-decoxy-3,3,3-trifluoropropanoate |
|---|---|
| PubChem CID | 22913241 |
| Molecular Formula | C21H31F3O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 1-phenylethyl 2-decoxy-3,3,3-trifluoropropanoate |
| SMILES | CCCCCCCCCCOC(C(=O)OC(C)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C21H31F3O3/c1-3-4-5-6-7-8-9-13-16-26-19(21(22,23)24)20(25)27-17(2)18-14-11-10-12-15-18/h10-12,14-15,17,19H,3-9,13,16H2,1-2H3 |
| InChIKey | UUTBMMFVIMUGKK-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|