C19H27F3O3 — CID 22913404
1-phenylethyl 3,3,3-trifluoro-2-octoxypropanoate (PubChem CID 22913404) has the molecular formula C19H27F3O3 and a molecular weight of 360.42 g/mol. Its IUPAC name is 1-phenylethyl 3,3,3-trifluoro-2-octoxypropanoate.
| Compound Name | 1-phenylethyl 3,3,3-trifluoro-2-octoxypropanoate |
|---|---|
| PubChem CID | 22913404 |
| Molecular Formula | C19H27F3O3 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | 1-phenylethyl 3,3,3-trifluoro-2-octoxypropanoate |
| SMILES | CCCCCCCCOC(C(=O)OC(C)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C19H27F3O3/c1-3-4-5-6-7-11-14-24-17(19(20,21)22)18(23)25-15(2)16-12-9-8-10-13-16/h8-10,12-13,15,17H,3-7,11,14H2,1-2H3 |
| InChIKey | ZEMKIRRXYICJSO-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|