C11H9F2NS — CID 22918262
1-ethyl-6,7-difluoroquinoline-4-thione (PubChem CID 22918262) has the molecular formula C11H9F2NS and a molecular weight of 225.26 g/mol. Its IUPAC name is 1-ethyl-6,7-difluoroquinoline-4-thione.
| Compound Name | 1-ethyl-6,7-difluoroquinoline-4-thione |
|---|---|
| PubChem CID | 22918262 |
| Molecular Formula | C11H9F2NS |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 1-ethyl-6,7-difluoroquinoline-4-thione |
| SMILES | CCn1ccc(=S)c2cc(F)c(F)cc21 |
| InChI | InChI=1S/C11H9F2NS/c1-2-14-4-3-11(15)7-5-8(12)9(13)6-10(7)14/h3-6H,2H2,1H3 |
| InChIKey | CBPLSNUYRNPJJR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|