C38H48N4O6 — CID 22932994
1,4-bis[3-[2-(3,4,5-trimethoxyphenyl)-3-pyridinyl]propyl]piperazine (PubChem CID 22932994) has the molecular formula C38H48N4O6 and a molecular weight of 656.82 g/mol. Its IUPAC name is 1,4-bis[3-[2-(3,4,5-trimethoxyphenyl)-3-pyridinyl]propyl]piperazine.
| Compound Name | 1,4-bis[3-[2-(3,4,5-trimethoxyphenyl)-3-pyridinyl]propyl]piperazine |
|---|---|
| PubChem CID | 22932994 |
| Molecular Formula | C38H48N4O6 |
| Molecular Weight | 656.82 g/mol |
| Exact Mass | 656.36 |
| IUPAC Name | 1,4-bis[3-[2-(3,4,5-trimethoxyphenyl)-3-pyridinyl]propyl]piperazine |
| SMILES | COc1cc(-c2ncccc2CCCN2CCN(CCCc3cccnc3-c3cc(OC)c(OC)c(OC)c3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C38H48N4O6/c1-43-31-23-29(24-32(44-2)37(31)47-5)35-27(11-7-15-39-35)13-9-17-41-19-21-42(22-20-41)18-10-14-28-12-8-16-40-36(28)30-25-33(45-3)38(48-6)34(26-30)46-4/h7-8,11-12,15-16,23-26H,9-10,13-14,17-22H2,1-6H3 |
| InChIKey | AEFWGGXERQHKDW-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 87.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.82 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |