C13H13N3O4S2 — CID 2293436
ethyl 2-(furan-2-carbonylcarbamothioylamino)-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 2293436) has the molecular formula C13H13N3O4S2 and a molecular weight of 339.40 g/mol. Its IUPAC name is ethyl 2-(furan-2-carbonylcarbamothioylamino)-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-(furan-2-carbonylcarbamothioylamino)-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 2293436 |
| Molecular Formula | C13H13N3O4S2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | ethyl 2-(furan-2-carbonylcarbamothioylamino)-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(NC(=S)NC(=O)c2ccco2)nc1C |
| InChI | InChI=1S/C13H13N3O4S2/c1-3-19-11(18)9-7(2)14-13(22-9)16-12(21)15-10(17)8-5-4-6-20-8/h4-6H,3H2,1-2H3,(H2,14,15,16,17,21) |
| InChIKey | VOIQFWHGPXADHK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|