C26H25F6IO3S — CID 22935068
bis(4-propylphenyl)iodanium;3,5-bis(trifluoromethyl)benzenesulfonate (PubChem CID 22935068) has the molecular formula C26H25F6IO3S and a molecular weight of 658.44 g/mol. Its IUPAC name is bis(4-propylphenyl)iodanium;3,5-bis(trifluoromethyl)benzenesulfonate.
| Compound Name | bis(4-propylphenyl)iodanium;3,5-bis(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 22935068 |
| Molecular Formula | C26H25F6IO3S |
| Molecular Weight | 658.44 g/mol |
| Exact Mass | 658.05 |
| IUPAC Name | bis(4-propylphenyl)iodanium;3,5-bis(trifluoromethyl)benzenesulfonate |
| SMILES | CCCc1ccc([I+]c2ccc(CCC)cc2)cc1.O=S(=O)([O-])c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H22I.C8H4F6O3S/c1-3-5-15-7-11-17(12-8-15)19-18-13-9-16(6-4-2)10-14-18;9-7(10,11)4-1-5(8(12,13)14)3-6(2-4)18(15,16)17/h7-14H,3-6H2,1-2H3;1-3H,(H,15,16,17)/q+1;/p-1 |
| InChIKey | WFYMXUKJIHCUJH-UHFFFAOYSA-M |
| XLogP | 4.35 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|