C23H22F3IO3S — CID 22935091
bis(4-ethylphenyl)iodanium;2-(trifluoromethyl)benzenesulfonate (PubChem CID 22935091) has the molecular formula C23H22F3IO3S and a molecular weight of 562.39 g/mol. Its IUPAC name is bis(4-ethylphenyl)iodanium;2-(trifluoromethyl)benzenesulfonate.
| Compound Name | bis(4-ethylphenyl)iodanium;2-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 22935091 |
| Molecular Formula | C23H22F3IO3S |
| Molecular Weight | 562.39 g/mol |
| Exact Mass | 562.03 |
| IUPAC Name | bis(4-ethylphenyl)iodanium;2-(trifluoromethyl)benzenesulfonate |
| SMILES | CCc1ccc([I+]c2ccc(CC)cc2)cc1.O=S(=O)([O-])c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H18I.C7H5F3O3S/c1-3-13-5-9-15(10-6-13)17-16-11-7-14(4-2)8-12-16;8-7(9,10)5-3-1-2-4-6(5)14(11,12)13/h5-12H,3-4H2,1-2H3;1-4H,(H,11,12,13)/q+1;/p-1 |
| InChIKey | MSWYZSBSCSJESM-UHFFFAOYSA-M |
| XLogP | 2.55 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|