C22H28N4O3S2 — CID 22939042
methyl 2-ethyl-6-methoxy-5-[[4-(2-methylsulfanylphenyl)piperazine-1-carbothioyl]amino]pyridine-3-carboxylate (PubChem CID 22939042) has the molecular formula C22H28N4O3S2 and a molecular weight of 460.63 g/mol. Its IUPAC name is methyl 2-ethyl-6-methoxy-5-[[4-(2-methylsulfanylphenyl)piperazine-1-carbothioyl]amino]pyridine-3-carboxylate.
| Compound Name | methyl 2-ethyl-6-methoxy-5-[[4-(2-methylsulfanylphenyl)piperazine-1-carbothioyl]amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 22939042 |
| Molecular Formula | C22H28N4O3S2 |
| Molecular Weight | 460.63 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | methyl 2-ethyl-6-methoxy-5-[[4-(2-methylsulfanylphenyl)piperazine-1-carbothioyl]amino]pyridine-3-carboxylate |
| SMILES | CCc1nc(OC)c(NC(=S)N2CCN(c3ccccc3SC)CC2)cc1C(=O)OC |
| InChI | InChI=1S/C22H28N4O3S2/c1-5-16-15(21(27)29-3)14-17(20(23-16)28-2)24-22(30)26-12-10-25(11-13-26)18-8-6-7-9-19(18)31-4/h6-9,14H,5,10-13H2,1-4H3,(H,24,30) |
| InChIKey | BEPXXCXNJQDIDF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.63 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|