C14H19O3Si — CID 22942593
CID 22942593 (PubChem CID 22942593) has the molecular formula C14H19O3Si and a molecular weight of 263.39 g/mol.
| Compound Name | CID 22942593 |
|---|---|
| PubChem CID | 22942593 |
| Molecular Formula | C14H19O3Si |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | — |
| SMILES | Oc1cccc(OC2CCCC(CC[Si])C2O)c1 |
| InChI | InChI=1S/C14H19O3Si/c15-11-4-2-5-12(9-11)17-13-6-1-3-10(7-8-18)14(13)16/h2,4-5,9-10,13-16H,1,3,6-8H2 |
| InChIKey | STECWVSVMOWQDE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|