About 6-methoxy-3-methyl-7H-pyrazolo[5,1-c][1,2,4]triazole
6-methoxy-3-methyl-7H-pyrazolo[5,1-c][1,2,4]triazole (PubChem CID 22944514) has the molecular formula C6H8N4O
and a molecular weight of 152.16 g/mol. Its IUPAC name is 6-methoxy-3-methyl-7H-pyrazolo[5,1-c][1,2,4]triazole.
Analyze 6-methoxy-3-methyl-7H-pyrazolo[5,1-c][1,2,4]triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-3-methyl-7H-pyrazolo[5,1-c][1,2,4]triazole?
The IUPAC name of 6-methoxy-3-methyl-7H-pyrazolo[5,1-c][1,2,4]triazole (CID 22944514) is 6-methoxy-3-methyl-7H-pyrazolo[5,1-c][1,2,4]triazole.
What is the SMILES notation for 6-methoxy-3-methyl-7H-pyrazolo[5,1-c][1,2,4]triazole?
The canonical SMILES for 6-methoxy-3-methyl-7H-pyrazolo[5,1-c][1,2,4]triazole is COC1=Nn2c(C)nnc2C1.
What is the InChIKey of 6-methoxy-3-methyl-7H-pyrazolo[5,1-c][1,2,4]triazole?
The InChIKey is KDOMERSGZNLKPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4O/c1-4-7-8-5-3-6(11-2)9-10(4)5/h3H2,1-2H3.
What are the key properties of 6-methoxy-3-methyl-7H-pyrazolo[5,1-c][1,2,4]triazole?
6-methoxy-3-methyl-7H-pyrazolo[5,1-c][1,2,4]triazole has a molecular weight of 152.16 g/mol, XLogP of -0.05, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-3-methyl-7H-pyrazolo[5,1-c][1,2,4]triazole is sourced from PubChem (CID 22944514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).