About 3,5-diethyl-1,2-diaza-4-azanidacyclopenta-2,5-diene
3,5-diethyl-1,2-diaza-4-azanidacyclopenta-2,5-diene (PubChem CID 102349375) has the molecular formula C6H10N3-
and a molecular weight of 124.17 g/mol. Its IUPAC name is 3,5-diethyl-1,2-diaza-4-azanidacyclopenta-2,5-diene.
Analyze 3,5-diethyl-1,2-diaza-4-azanidacyclopenta-2,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-diethyl-1,2-diaza-4-azanidacyclopenta-2,5-diene?
The IUPAC name of 3,5-diethyl-1,2-diaza-4-azanidacyclopenta-2,5-diene (CID 102349375) is 3,5-diethyl-1,2-diaza-4-azanidacyclopenta-2,5-diene.
What is the SMILES notation for 3,5-diethyl-1,2-diaza-4-azanidacyclopenta-2,5-diene?
The canonical SMILES for 3,5-diethyl-1,2-diaza-4-azanidacyclopenta-2,5-diene is CCc1nnc(CC)[n-]1.
What is the InChIKey of 3,5-diethyl-1,2-diaza-4-azanidacyclopenta-2,5-diene?
The InChIKey is GCKJVISZKSHSTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N3/c1-3-5-7-6(4-2)9-8-5/h3-4H2,1-2H3/q-1.
What are the key properties of 3,5-diethyl-1,2-diaza-4-azanidacyclopenta-2,5-diene?
3,5-diethyl-1,2-diaza-4-azanidacyclopenta-2,5-diene has a molecular weight of 124.17 g/mol, XLogP of 0.56, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-diethyl-1,2-diaza-4-azanidacyclopenta-2,5-diene is sourced from PubChem (CID 102349375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).