C19H13NO6S — CID 22947318
(1,3-dioxoisoindol-2-yl) (4-methoxynaphthalen-1-yl) sulfite (PubChem CID 22947318) has the molecular formula C19H13NO6S and a molecular weight of 383.38 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl) (4-methoxynaphthalen-1-yl) sulfite.
| Compound Name | (1,3-dioxoisoindol-2-yl) (4-methoxynaphthalen-1-yl) sulfite |
|---|---|
| PubChem CID | 22947318 |
| Molecular Formula | C19H13NO6S |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl) (4-methoxynaphthalen-1-yl) sulfite |
| SMILES | COc1ccc(OS(=O)ON2C(=O)c3ccccc3C2=O)c2ccccc12 |
| InChI | InChI=1S/C19H13NO6S/c1-24-16-10-11-17(13-7-3-2-6-12(13)16)25-27(23)26-20-18(21)14-8-4-5-9-15(14)19(20)22/h2-11H,1H3 |
| InChIKey | MIKPBPLWEWAYIA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|