C16H21N5 — CID 22948906
3,4,5,6,7-pentamethyl-1-[(1-methyl-1,2,4-triazol-3-yl)methyl]indazole (PubChem CID 22948906) has the molecular formula C16H21N5 and a molecular weight of 283.38 g/mol. Its IUPAC name is 3,4,5,6,7-pentamethyl-1-[(1-methyl-1,2,4-triazol-3-yl)methyl]indazole.
| Compound Name | 3,4,5,6,7-pentamethyl-1-[(1-methyl-1,2,4-triazol-3-yl)methyl]indazole |
|---|---|
| PubChem CID | 22948906 |
| Molecular Formula | C16H21N5 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 3,4,5,6,7-pentamethyl-1-[(1-methyl-1,2,4-triazol-3-yl)methyl]indazole |
| SMILES | Cc1c(C)c(C)c2c(c(C)nn2Cc2ncn(C)n2)c1C |
| InChI | InChI=1S/C16H21N5/c1-9-10(2)12(4)16-15(11(9)3)13(5)18-21(16)7-14-17-8-20(6)19-14/h8H,7H2,1-6H3 |
| InChIKey | VJTWGMRHVWYLNR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |