C34H42N4 — CID 59181170
3,4,5,6,7-pentamethyl-1-[2,3,5,6-tetramethyl-4-(3,4,5,6,7-pentamethylindazol-1-yl)phenyl]indazole (PubChem CID 59181170) has the molecular formula C34H42N4 and a molecular weight of 506.74 g/mol. Its IUPAC name is 3,4,5,6,7-pentamethyl-1-[2,3,5,6-tetramethyl-4-(3,4,5,6,7-pentamethylindazol-1-yl)phenyl]indazole.
| Compound Name | 3,4,5,6,7-pentamethyl-1-[2,3,5,6-tetramethyl-4-(3,4,5,6,7-pentamethylindazol-1-yl)phenyl]indazole |
|---|---|
| PubChem CID | 59181170 |
| Molecular Formula | C34H42N4 |
| Molecular Weight | 506.74 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | 3,4,5,6,7-pentamethyl-1-[2,3,5,6-tetramethyl-4-(3,4,5,6,7-pentamethylindazol-1-yl)phenyl]indazole |
| SMILES | Cc1c(C)c(-n2nc(C)c3c(C)c(C)c(C)c(C)c32)c(C)c(C)c1-n1nc(C)c2c(C)c(C)c(C)c(C)c21 |
| InChI | InChI=1S/C34H42N4/c1-15-17(3)21(7)33-29(19(15)5)27(13)35-37(33)31-23(9)25(11)32(26(12)24(31)10)38-34-22(8)18(4)16(2)20(6)30(34)28(14)36-38/h1-14H3 |
| InChIKey | QUBHBKHOIZKDKP-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.74 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |