C42H54N6Si — CID 59246698
dimethyl-bis[2,3,5,6-tetramethyl-4-(4,5,6,7-tetramethylbenzotriazol-1-yl)phenyl]silane (PubChem CID 59246698) has the molecular formula C42H54N6Si and a molecular weight of 671.02 g/mol. Its IUPAC name is dimethyl-bis[2,3,5,6-tetramethyl-4-(4,5,6,7-tetramethylbenzotriazol-1-yl)phenyl]silane.
| Compound Name | dimethyl-bis[2,3,5,6-tetramethyl-4-(4,5,6,7-tetramethylbenzotriazol-1-yl)phenyl]silane |
|---|---|
| PubChem CID | 59246698 |
| Molecular Formula | C42H54N6Si |
| Molecular Weight | 671.02 g/mol |
| Exact Mass | 670.42 |
| IUPAC Name | dimethyl-bis[2,3,5,6-tetramethyl-4-(4,5,6,7-tetramethylbenzotriazol-1-yl)phenyl]silane |
| SMILES | Cc1c(C)c([Si](C)(C)c2c(C)c(C)c(-n3nnc4c(C)c(C)c(C)c(C)c43)c(C)c2C)c(C)c(C)c1-n1nnc2c(C)c(C)c(C)c(C)c21 |
| InChI | InChI=1S/C42H54N6Si/c1-19-21(3)25(7)39-35(23(19)5)43-45-47(39)37-27(9)31(13)41(32(14)28(37)10)49(17,18)42-33(15)29(11)38(30(12)34(42)16)48-40-26(8)22(4)20(2)24(6)36(40)44-46-48/h1-18H3 |
| InChIKey | QLWGVTOFAJYDTA-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.02 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|