C30H36N6 — CID 59246644
1,4,6,7-tetramethyl-5-[2,3,5,6-tetramethyl-4-(1,4,6,7-tetramethylbenzotriazol-5-yl)phenyl]benzotriazole (PubChem CID 59246644) has the molecular formula C30H36N6 and a molecular weight of 480.66 g/mol. Its IUPAC name is 1,4,6,7-tetramethyl-5-[2,3,5,6-tetramethyl-4-(1,4,6,7-tetramethylbenzotriazol-5-yl)phenyl]benzotriazole.
| Compound Name | 1,4,6,7-tetramethyl-5-[2,3,5,6-tetramethyl-4-(1,4,6,7-tetramethylbenzotriazol-5-yl)phenyl]benzotriazole |
|---|---|
| PubChem CID | 59246644 |
| Molecular Formula | C30H36N6 |
| Molecular Weight | 480.66 g/mol |
| Exact Mass | 480.30 |
| IUPAC Name | 1,4,6,7-tetramethyl-5-[2,3,5,6-tetramethyl-4-(1,4,6,7-tetramethylbenzotriazol-5-yl)phenyl]benzotriazole |
| SMILES | Cc1c(C)c(-c2c(C)c(C)c3c(nnn3C)c2C)c(C)c(C)c1-c1c(C)c(C)c2c(nnn2C)c1C |
| InChI | InChI=1S/C30H36N6/c1-13-14(2)24(26-18(6)20(8)30-28(22(26)10)32-34-36(30)12)16(4)15(3)23(13)25-17(5)19(7)29-27(21(25)9)31-33-35(29)11/h1-12H3 |
| InChIKey | OCRGSVANFAHWSE-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.66 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |