C43H54N6 — CID 59246650
1,4,6,7-tetramethyl-5-[2,3,5,6-tetramethyl-4-[2-[2,3,5,6-tetramethyl-4-(1,4,6,7-tetramethylbenzotriazol-5-yl)phenyl]propan-2-yl]phenyl]benzotriazole (PubChem CID 59246650) has the molecular formula C43H54N6 and a molecular weight of 654.95 g/mol. Its IUPAC name is 1,4,6,7-tetramethyl-5-[2,3,5,6-tetramethyl-4-[2-[2,3,5,6-tetramethyl-4-(1,4,6,7-tetramethylbenzotriazol-5-yl)phenyl]propan-2-yl]phenyl]benzotriazole.
| Compound Name | 1,4,6,7-tetramethyl-5-[2,3,5,6-tetramethyl-4-[2-[2,3,5,6-tetramethyl-4-(1,4,6,7-tetramethylbenzotriazol-5-yl)phenyl]propan-2-yl]phenyl]benzotriazole |
|---|---|
| PubChem CID | 59246650 |
| Molecular Formula | C43H54N6 |
| Molecular Weight | 654.95 g/mol |
| Exact Mass | 654.44 |
| IUPAC Name | 1,4,6,7-tetramethyl-5-[2,3,5,6-tetramethyl-4-[2-[2,3,5,6-tetramethyl-4-(1,4,6,7-tetramethylbenzotriazol-5-yl)phenyl]propan-2-yl]phenyl]benzotriazole |
| SMILES | Cc1c(C)c(C(C)(C)c2c(C)c(C)c(-c3c(C)c(C)c4c(nnn4C)c3C)c(C)c2C)c(C)c(C)c1-c1c(C)c(C)c2c(nnn2C)c1C |
| InChI | InChI=1S/C43H54N6/c1-19-25(7)37(26(8)20(2)33(19)35-23(5)29(11)41-39(31(35)13)44-46-48(41)17)43(15,16)38-27(9)21(3)34(22(4)28(38)10)36-24(6)30(12)42-40(32(36)14)45-47-49(42)18/h1-18H3 |
| InChIKey | CPGZQJZYNNKORG-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.95 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |