C47H60N4 — CID 59181203
1,3,4,6,7-pentamethyl-5-[2,3,5,6-tetramethyl-4-[2-[2,3,5,6-tetramethyl-4-(1,3,4,6,7-pentamethylindazol-5-yl)phenyl]propan-2-yl]phenyl]indazole (PubChem CID 59181203) has the molecular formula C47H60N4 and a molecular weight of 681.03 g/mol. Its IUPAC name is 1,3,4,6,7-pentamethyl-5-[2,3,5,6-tetramethyl-4-[2-[2,3,5,6-tetramethyl-4-(1,3,4,6,7-pentamethylindazol-5-yl)phenyl]propan-2-yl]phenyl]indazole.
| Compound Name | 1,3,4,6,7-pentamethyl-5-[2,3,5,6-tetramethyl-4-[2-[2,3,5,6-tetramethyl-4-(1,3,4,6,7-pentamethylindazol-5-yl)phenyl]propan-2-yl]phenyl]indazole |
|---|---|
| PubChem CID | 59181203 |
| Molecular Formula | C47H60N4 |
| Molecular Weight | 681.03 g/mol |
| Exact Mass | 680.48 |
| IUPAC Name | 1,3,4,6,7-pentamethyl-5-[2,3,5,6-tetramethyl-4-[2-[2,3,5,6-tetramethyl-4-(1,3,4,6,7-pentamethylindazol-5-yl)phenyl]propan-2-yl]phenyl]indazole |
| SMILES | Cc1c(C)c(C(C)(C)c2c(C)c(C)c(-c3c(C)c(C)c4c(c(C)nn4C)c3C)c(C)c2C)c(C)c(C)c1-c1c(C)c(C)c2c(c(C)nn2C)c1C |
| InChI | InChI=1S/C47H60N4/c1-21-27(7)43(28(8)22(2)37(21)39-25(5)31(11)45-41(33(39)13)35(15)48-50(45)19)47(17,18)44-29(9)23(3)38(24(4)30(44)10)40-26(6)32(12)46-42(34(40)14)36(16)49-51(46)20/h1-20H3 |
| InChIKey | AVIDLUSUEKOJGI-UHFFFAOYSA-N |
| XLogP | 12.05 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.03 |
| LogP ≤ 5 | 12.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |