C55H66N4 — CID 59181223
1-[1,2,3,4,5,6,8-heptamethyl-9-(3,4,5,6,7-pentamethylindazol-1-yl)-7-(2,3,4,5,6-pentamethylphenyl)fluoren-9-yl]-3,4,5,6,7-pentamethylindazole (PubChem CID 59181223) has the molecular formula C55H66N4 and a molecular weight of 783.16 g/mol. Its IUPAC name is 1-[1,2,3,4,5,6,8-heptamethyl-9-(3,4,5,6,7-pentamethylindazol-1-yl)-7-(2,3,4,5,6-pentamethylphenyl)fluoren-9-yl]-3,4,5,6,7-pentamethylindazole.
| Compound Name | 1-[1,2,3,4,5,6,8-heptamethyl-9-(3,4,5,6,7-pentamethylindazol-1-yl)-7-(2,3,4,5,6-pentamethylphenyl)fluoren-9-yl]-3,4,5,6,7-pentamethylindazole |
|---|---|
| PubChem CID | 59181223 |
| Molecular Formula | C55H66N4 |
| Molecular Weight | 783.16 g/mol |
| Exact Mass | 782.53 |
| IUPAC Name | 1-[1,2,3,4,5,6,8-heptamethyl-9-(3,4,5,6,7-pentamethylindazol-1-yl)-7-(2,3,4,5,6-pentamethylphenyl)fluoren-9-yl]-3,4,5,6,7-pentamethylindazole |
| SMILES | Cc1c(C)c(C)c(-c2c(C)c(C)c3c(c2C)C(n2nc(C)c4c(C)c(C)c(C)c(C)c42)(n2nc(C)c4c(C)c(C)c(C)c(C)c42)c2c(C)c(C)c(C)c(C)c2-3)c(C)c1C |
| InChI | InChI=1S/C55H66N4/c1-23-24(2)32(10)45(33(11)25(23)3)46-37(15)38(16)50-49-36(14)26(4)29(7)39(17)51(49)55(52(50)42(46)20,58-53-40(18)30(8)27(5)34(12)47(53)43(21)56-58)59-54-41(19)31(9)28(6)35(13)48(54)44(22)57-59/h1-22H3 |
| InChIKey | ZVTOBUOMCWEEKH-UHFFFAOYSA-N |
| XLogP | 14.12 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.16 |
| LogP ≤ 5 | 14.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |