C22H31N — CID 158365814
methane;1,2,3,4,5,6,7,8,9-nonamethylcarbazole (PubChem CID 158365814) has the molecular formula C22H31N and a molecular weight of 309.50 g/mol. Its IUPAC name is methane;1,2,3,4,5,6,7,8,9-nonamethylcarbazole.
| Compound Name | methane;1,2,3,4,5,6,7,8,9-nonamethylcarbazole |
|---|---|
| PubChem CID | 158365814 |
| Molecular Formula | C22H31N |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.25 |
| IUPAC Name | methane;1,2,3,4,5,6,7,8,9-nonamethylcarbazole |
| SMILES | C.Cc1c(C)c(C)c2c(c1C)c1c(C)c(C)c(C)c(C)c1n2C |
| InChI | InChI=1S/C21H27N.CH4/c1-10-12(3)16(7)20-18(14(10)5)19-15(6)11(2)13(4)17(8)21(19)22(20)9;/h1-9H3;1H4 |
| InChIKey | GTZWTEXWHKVKMU-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |