C26H40N- — CID 157093182
1,2,3,4,5,6,7-heptamethylindole;methane;1,2,3,4,5-pentamethylcyclopenta-1,3-diene (PubChem CID 157093182) has the molecular formula C26H40N- and a molecular weight of 366.61 g/mol. Its IUPAC name is 1,2,3,4,5,6,7-heptamethylindole;methane;1,2,3,4,5-pentamethylcyclopenta-1,3-diene.
| Compound Name | 1,2,3,4,5,6,7-heptamethylindole;methane;1,2,3,4,5-pentamethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 157093182 |
| Molecular Formula | C26H40N- |
| Molecular Weight | 366.61 g/mol |
| Exact Mass | 366.32 |
| IUPAC Name | 1,2,3,4,5,6,7-heptamethylindole;methane;1,2,3,4,5-pentamethylcyclopenta-1,3-diene |
| SMILES | C.Cc1c(C)c(C)[c-](C)c1C.Cc1c(C)c(C)c2c(c1C)c(C)c(C)n2C |
| InChI | InChI=1S/C15H21N.C10H15.CH4/c1-8-9(2)11(4)15-14(10(8)3)12(5)13(6)16(15)7;1-6-7(2)9(4)10(5)8(6)3;/h1-7H3;1-5H3;1H4/q;-1; |
| InChIKey | AEXDHKQHZRHFHS-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.61 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|