C15H21IN2 — CID 131730211
1-(1,2,4,5,6,7-hexamethylindol-3-yl)-N-iodomethanamine (PubChem CID 131730211) has the molecular formula C15H21IN2 and a molecular weight of 356.25 g/mol. Its IUPAC name is 1-(1,2,4,5,6,7-hexamethylindol-3-yl)-N-iodomethanamine.
| Compound Name | 1-(1,2,4,5,6,7-hexamethylindol-3-yl)-N-iodomethanamine |
|---|---|
| PubChem CID | 131730211 |
| Molecular Formula | C15H21IN2 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 1-(1,2,4,5,6,7-hexamethylindol-3-yl)-N-iodomethanamine |
| SMILES | Cc1c(C)c(C)c2c(c1C)c(CNI)c(C)n2C |
| InChI | InChI=1S/C15H21IN2/c1-8-9(2)11(4)15-14(10(8)3)13(7-17-16)12(5)18(15)6/h17H,7H2,1-6H3 |
| InChIKey | JJGZLBMKQXISRV-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|