C25H33N — CID 23527720
1,2,3,4,5,7,8,9-octamethyl-6-(3-methylbut-2-en-2-yl)carbazole (PubChem CID 23527720) has the molecular formula C25H33N and a molecular weight of 347.55 g/mol. Its IUPAC name is 1,2,3,4,5,7,8,9-octamethyl-6-(3-methylbut-2-en-2-yl)carbazole.
| Compound Name | 1,2,3,4,5,7,8,9-octamethyl-6-(3-methylbut-2-en-2-yl)carbazole |
|---|---|
| PubChem CID | 23527720 |
| Molecular Formula | C25H33N |
| Molecular Weight | 347.55 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | 1,2,3,4,5,7,8,9-octamethyl-6-(3-methylbut-2-en-2-yl)carbazole |
| SMILES | CC(C)=C(C)c1c(C)c(C)c2c(c1C)c1c(C)c(C)c(C)c(C)c1n2C |
| InChI | InChI=1S/C25H33N/c1-12(2)13(3)21-17(7)19(9)25-23(20(21)10)22-16(6)14(4)15(5)18(8)24(22)26(25)11/h1-11H3 |
| InChIKey | GQGKFZUFHPEFBY-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.55 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |