C27H35N — CID 161280737
(3Z)-1,4,5,6,7-pentamethyl-2-methylidene-3-[1-(2,3,4,5,6-pentamethylphenyl)ethylidene]indole (PubChem CID 161280737) has the molecular formula C27H35N and a molecular weight of 373.58 g/mol. Its IUPAC name is (3Z)-1,4,5,6,7-pentamethyl-2-methylidene-3-[1-(2,3,4,5,6-pentamethylphenyl)ethylidene]indole.
| Compound Name | (3Z)-1,4,5,6,7-pentamethyl-2-methylidene-3-[1-(2,3,4,5,6-pentamethylphenyl)ethylidene]indole |
|---|---|
| PubChem CID | 161280737 |
| Molecular Formula | C27H35N |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 373.28 |
| IUPAC Name | (3Z)-1,4,5,6,7-pentamethyl-2-methylidene-3-[1-(2,3,4,5,6-pentamethylphenyl)ethylidene]indole |
| SMILES | C=c1/c(=C(/C)c2c(C)c(C)c(C)c(C)c2C)c2c(C)c(C)c(C)c(C)c2n1C |
| InChI | InChI=1S/C27H35N/c1-13-14(2)18(6)24(19(7)15(13)3)22(10)25-23(11)28(12)27-21(9)17(5)16(4)20(8)26(25)27/h11H2,1-10,12H3/b25-22+ |
| InChIKey | CEONPNPLQXDALX-YYDJUVGSSA-N |
| XLogP | 5.58 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |