C27H35I2N — CID 161280736
molecular iodine;(3Z)-1,4,5,6,7-pentamethyl-2-methylidene-3-[1-(2,3,4,5,6-pentamethylphenyl)ethylidene]indole (PubChem CID 161280736) has the molecular formula C27H35I2N and a molecular weight of 627.39 g/mol. Its IUPAC name is molecular iodine;(3Z)-1,4,5,6,7-pentamethyl-2-methylidene-3-[1-(2,3,4,5,6-pentamethylphenyl)ethylidene]indole.
| Compound Name | molecular iodine;(3Z)-1,4,5,6,7-pentamethyl-2-methylidene-3-[1-(2,3,4,5,6-pentamethylphenyl)ethylidene]indole |
|---|---|
| PubChem CID | 161280736 |
| Molecular Formula | C27H35I2N |
| Molecular Weight | 627.39 g/mol |
| Exact Mass | 627.09 |
| IUPAC Name | molecular iodine;(3Z)-1,4,5,6,7-pentamethyl-2-methylidene-3-[1-(2,3,4,5,6-pentamethylphenyl)ethylidene]indole |
| SMILES | C=c1/c(=C(/C)c2c(C)c(C)c(C)c(C)c2C)c2c(C)c(C)c(C)c(C)c2n1C.II |
| InChI | InChI=1S/C27H35N.I2/c1-13-14(2)18(6)24(19(7)15(13)3)22(10)25-23(11)28(12)27-21(9)17(5)16(4)20(8)26(25)27;1-2/h11H2,1-10,12H3;/b25-22+; |
| InChIKey | VFAXTPGDGWIUNV-OSMRDGEFSA-N |
| XLogP | 7.35 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.39 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|