C14H17Cl2N3O2S — CID 22951398
N-(2,6-dichloro-4-nitrophenyl)-3-(2-methylbutyl)-1,3-thiazolidin-2-imine (PubChem CID 22951398) has the molecular formula C14H17Cl2N3O2S and a molecular weight of 362.28 g/mol. Its IUPAC name is N-(2,6-dichloro-4-nitrophenyl)-3-(2-methylbutyl)-1,3-thiazolidin-2-imine.
| Compound Name | N-(2,6-dichloro-4-nitrophenyl)-3-(2-methylbutyl)-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 22951398 |
| Molecular Formula | C14H17Cl2N3O2S |
| Molecular Weight | 362.28 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | N-(2,6-dichloro-4-nitrophenyl)-3-(2-methylbutyl)-1,3-thiazolidin-2-imine |
| SMILES | CCC(C)CN1CCS/C1=N\c1c(Cl)cc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C14H17Cl2N3O2S/c1-3-9(2)8-18-4-5-22-14(18)17-13-11(15)6-10(19(20)21)7-12(13)16/h6-7,9H,3-5,8H2,1-2H3/b17-14- |
| InChIKey | VTXPSDPKWSIKGX-VKAVYKQESA-N |
| XLogP | 4.98 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.28 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|