C23H31N4O4+ — CID 22952608
2-[[2-[2-[2-[2-(1-butylpyridin-1-ium-4-yl)ethyl]phenyl]hydrazinyl]-2-oxoacetyl]-methylamino]ethyl formate (PubChem CID 22952608) has the molecular formula C23H31N4O4+ and a molecular weight of 427.53 g/mol. Its IUPAC name is 2-[[2-[2-[2-[2-(1-butylpyridin-1-ium-4-yl)ethyl]phenyl]hydrazinyl]-2-oxoacetyl]-methylamino]ethyl formate.
| Compound Name | 2-[[2-[2-[2-[2-(1-butylpyridin-1-ium-4-yl)ethyl]phenyl]hydrazinyl]-2-oxoacetyl]-methylamino]ethyl formate |
|---|---|
| PubChem CID | 22952608 |
| Molecular Formula | C23H31N4O4+ |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 2-[[2-[2-[2-[2-(1-butylpyridin-1-ium-4-yl)ethyl]phenyl]hydrazinyl]-2-oxoacetyl]-methylamino]ethyl formate |
| SMILES | CCCC[n+]1ccc(CCc2ccccc2NNC(=O)C(=O)N(C)CCOC=O)cc1 |
| InChI | InChI=1S/C23H30N4O4/c1-3-4-13-27-14-11-19(12-15-27)9-10-20-7-5-6-8-21(20)24-25-22(29)23(30)26(2)16-17-31-18-28/h5-8,11-12,14-15,18H,3-4,9-10,13,16-17H2,1-2H3,(H-,24,25,29,30)/p+1 |
| InChIKey | KPPATIQQKKGEHO-UHFFFAOYSA-O |
| XLogP | 1.63 |
| TPSA | 91.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|