C29H37IN4O4 — CID 159379677
N-[2-(3,4-dihydroxyphenyl)ethyl]-2-[2-[2-[2-(1-hexylpyridin-1-ium-4-yl)ethyl]phenyl]hydrazinyl]-2-oxoacetamide iodide (PubChem CID 159379677) has the molecular formula C29H37IN4O4 and a molecular weight of 632.54 g/mol. Its IUPAC name is N-[2-(3,4-dihydroxyphenyl)ethyl]-2-[2-[2-[2-(1-hexylpyridin-1-ium-4-yl)ethyl]phenyl]hydrazinyl]-2-oxoacetamide iodide.
| Compound Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-2-[2-[2-[2-(1-hexylpyridin-1-ium-4-yl)ethyl]phenyl]hydrazinyl]-2-oxoacetamide iodide |
|---|---|
| PubChem CID | 159379677 |
| Molecular Formula | C29H37IN4O4 |
| Molecular Weight | 632.54 g/mol |
| Exact Mass | 632.19 |
| IUPAC Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-2-[2-[2-[2-(1-hexylpyridin-1-ium-4-yl)ethyl]phenyl]hydrazinyl]-2-oxoacetamide iodide |
| SMILES | CCCCCC[n+]1ccc(CCc2ccccc2NNC(=O)C(=O)NCCc2ccc(O)c(O)c2)cc1.[I-] |
| InChI | InChI=1S/C29H36N4O4.HI/c1-2-3-4-7-18-33-19-15-22(16-20-33)10-12-24-8-5-6-9-25(24)31-32-29(37)28(36)30-17-14-23-11-13-26(34)27(35)21-23;/h5-6,8-9,11,13,15-16,19-21H,2-4,7,10,12,14,17-18H2,1H3,(H4-,30,31,32,34,35,36,37);1H |
| InChIKey | MOLKDFWGFDCJCW-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 114.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.54 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|