C22H33I2N5O2 — CID 159443515
trimethyl-[3-[[2-[2-[2-[2-(1-methylpyridin-1-ium-4-yl)ethyl]phenyl]hydrazinyl]-2-oxoacetyl]amino]propyl]azanium diiodide (PubChem CID 159443515) has the molecular formula C22H33I2N5O2 and a molecular weight of 653.35 g/mol. Its IUPAC name is trimethyl-[3-[[2-[2-[2-[2-(1-methylpyridin-1-ium-4-yl)ethyl]phenyl]hydrazinyl]-2-oxoacetyl]amino]propyl]azanium diiodide.
| Compound Name | trimethyl-[3-[[2-[2-[2-[2-(1-methylpyridin-1-ium-4-yl)ethyl]phenyl]hydrazinyl]-2-oxoacetyl]amino]propyl]azanium diiodide |
|---|---|
| PubChem CID | 159443515 |
| Molecular Formula | C22H33I2N5O2 |
| Molecular Weight | 653.35 g/mol |
| Exact Mass | 653.07 |
| IUPAC Name | trimethyl-[3-[[2-[2-[2-[2-(1-methylpyridin-1-ium-4-yl)ethyl]phenyl]hydrazinyl]-2-oxoacetyl]amino]propyl]azanium diiodide |
| SMILES | C[n+]1ccc(CCc2ccccc2NNC(=O)C(=O)NCCC[N+](C)(C)C)cc1.[I-].[I-] |
| InChI | InChI=1S/C22H31N5O2.2HI/c1-26-15-12-18(13-16-26)10-11-19-8-5-6-9-20(19)24-25-22(29)21(28)23-14-7-17-27(2,3)4;;/h5-6,8-9,12-13,15-16H,7,10-11,14,17H2,1-4H3,(H-2,23,24,25,28,29);2*1H |
| InChIKey | YQSDKJKHBJLNMN-UHFFFAOYSA-N |
| XLogP | -5.04 |
| TPSA | 74.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.35 |
| LogP ≤ 5 | -5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|