C9H18AcN2O3 — CID 22958834
actinium;hydroxymethyl N-[2-(methylamino)cyclohexyl]carbamate (PubChem CID 22958834) has the molecular formula C9H18AcN2O3 and a molecular weight of 429.25 g/mol. Its IUPAC name is actinium;hydroxymethyl N-[2-(methylamino)cyclohexyl]carbamate.
| Compound Name | actinium;hydroxymethyl N-[2-(methylamino)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 22958834 |
| Molecular Formula | C9H18AcN2O3 |
| Molecular Weight | 429.25 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | actinium;hydroxymethyl N-[2-(methylamino)cyclohexyl]carbamate |
| SMILES | CNC1CCCCC1NC(=O)OCO.[Ac] |
| InChI | InChI=1S/C9H18N2O3.Ac/c1-10-7-4-2-3-5-8(7)11-9(13)14-6-12;/h7-8,10,12H,2-6H2,1H3,(H,11,13); |
| InChIKey | FRGFNOHUXXAGQA-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.25 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|