C13H10N2O2 — CID 22960616
3-methyl-1H-benzo[g]quinazoline-2,4-dione (PubChem CID 22960616) has the molecular formula C13H10N2O2 and a molecular weight of 226.24 g/mol. Its IUPAC name is 3-methyl-1H-benzo[g]quinazoline-2,4-dione.
| Compound Name | 3-methyl-1H-benzo[g]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 22960616 |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 3-methyl-1H-benzo[g]quinazoline-2,4-dione |
| SMILES | Cn1c(=O)[nH]c2cc3ccccc3cc2c1=O |
| InChI | InChI=1S/C13H10N2O2/c1-15-12(16)10-6-8-4-2-3-5-9(8)7-11(10)14-13(15)17/h2-7H,1H3,(H,14,17) |
| InChIKey | RFSRFBQPGYJSLK-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|