C6H9F2O12P3-4 — CID 22965167
[[(4,4-difluoro-3-hydroxy-5-methyloxolan-2-yl)methoxy-oxidophosphoryl]oxy-oxidophosphoryl] phosphate (PubChem CID 22965167) has the molecular formula C6H9F2O12P3-4 and a molecular weight of 404.04 g/mol. Its IUPAC name is [[(4,4-difluoro-3-hydroxy-5-methyloxolan-2-yl)methoxy-oxidophosphoryl]oxy-oxidophosphoryl] phosphate.
| Compound Name | [[(4,4-difluoro-3-hydroxy-5-methyloxolan-2-yl)methoxy-oxidophosphoryl]oxy-oxidophosphoryl] phosphate |
|---|---|
| PubChem CID | 22965167 |
| Molecular Formula | C6H9F2O12P3-4 |
| Molecular Weight | 404.04 g/mol |
| Exact Mass | 403.93 |
| IUPAC Name | [[(4,4-difluoro-3-hydroxy-5-methyloxolan-2-yl)methoxy-oxidophosphoryl]oxy-oxidophosphoryl] phosphate |
| SMILES | CC1OC(COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C(O)C1(F)F |
| InChI | InChI=1S/C6H13F2O12P3/c1-3-6(7,8)5(9)4(18-3)2-17-22(13,14)20-23(15,16)19-21(10,11)12/h3-5,9H,2H2,1H3,(H,13,14)(H,15,16)(H2,10,11,12)/p-4 |
| InChIKey | CDFLKDIVMJYKLK-UHFFFAOYSA-J |
| XLogP | -2.41 |
| TPSA | 200.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.04 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|