C6H10FO12P3-4 — CID 59905592
[[[(2S,5S)-2-fluoro-3-hydroxy-5-methyloxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] phosphate (PubChem CID 59905592) has the molecular formula C6H10FO12P3-4 and a molecular weight of 386.05 g/mol. Its IUPAC name is [[[(2S,5S)-2-fluoro-3-hydroxy-5-methyloxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] phosphate.
| Compound Name | [[[(2S,5S)-2-fluoro-3-hydroxy-5-methyloxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] phosphate |
|---|---|
| PubChem CID | 59905592 |
| Molecular Formula | C6H10FO12P3-4 |
| Molecular Weight | 386.05 g/mol |
| Exact Mass | 385.94 |
| IUPAC Name | [[[(2S,5S)-2-fluoro-3-hydroxy-5-methyloxolan-2-yl]methoxy-oxidophosphoryl]oxy-oxidophosphoryl] phosphate |
| SMILES | C[C@H]1CC(O)[C@@](F)(COP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])O1 |
| InChI | InChI=1S/C6H14FO12P3/c1-4-2-5(8)6(7,17-4)3-16-21(12,13)19-22(14,15)18-20(9,10)11/h4-5,8H,2-3H2,1H3,(H,12,13)(H,14,15)(H2,9,10,11)/p-4/t4-,5?,6+/m0/s1 |
| InChIKey | GAVJHYNACOTWJZ-NOWQFEBASA-J |
| XLogP | -2.36 |
| TPSA | 200.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.05 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|